About lithium;diacetyloxyphosphoryl acetate;hydride
lithium;diacetyloxyphosphoryl acetate;hydride (PubChem CID 175589936) has the molecular formula C6H10LiO7P
and a molecular weight of 232.05 g/mol. Its IUPAC name is lithium;diacetyloxyphosphoryl acetate;hydride.
Molecular Properties
| Compound Name | lithium;diacetyloxyphosphoryl acetate;hydride |
| PubChem CID | 175589936 |
| Molecular Formula | C6H10LiO7P |
| Molecular Weight | 232.05 g/mol |
| Exact Mass | 232.03 |
| IUPAC Name | lithium;diacetyloxyphosphoryl acetate;hydride |
| SMILES | CC(=O)OP(=O)(OC(C)=O)OC(C)=O.[H-].[Li+] |
| InChI | InChI=1S/C6H9O7P.Li.H/c1-4(7)11-14(10,12-5(2)8)13-6(3)9;;/h1-3H3;;/q;+1;-1 |
| InChIKey | NTPAHXZMHBRFNL-UHFFFAOYSA-N |
| XLogP | -2.10 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.05 |
| LogP ≤ 5 | -2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lithium;diacetyloxyphosphoryl acetate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;diacetyloxyphosphoryl acetate;hydride?
The IUPAC name of lithium;diacetyloxyphosphoryl acetate;hydride (CID 175589936) is lithium;diacetyloxyphosphoryl acetate;hydride.
What is the SMILES notation for lithium;diacetyloxyphosphoryl acetate;hydride?
The canonical SMILES for lithium;diacetyloxyphosphoryl acetate;hydride is CC(=O)OP(=O)(OC(C)=O)OC(C)=O.[H-].[Li+].
What is the InChIKey of lithium;diacetyloxyphosphoryl acetate;hydride?
The InChIKey is NTPAHXZMHBRFNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9O7P.Li.H/c1-4(7)11-14(10,12-5(2)8)13-6(3)9;;/h1-3H3;;/q;+1;-1.
What are the key properties of lithium;diacetyloxyphosphoryl acetate;hydride?
lithium;diacetyloxyphosphoryl acetate;hydride has a molecular weight of 232.05 g/mol, XLogP of -2.10, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;diacetyloxyphosphoryl acetate;hydride is sourced from PubChem (CID 175589936), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).