About acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate
acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate (PubChem CID 88649282) has the molecular formula C10H16O13P2
and a molecular weight of 406.17 g/mol. Its IUPAC name is acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate.
Molecular Properties
| Compound Name | acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate |
| PubChem CID | 88649282 |
| Molecular Formula | C10H16O13P2 |
| Molecular Weight | 406.17 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate |
| SMILES | CC(=O)O.CC(=O)OP(=O)(OC(C)=O)OP(=O)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C8H12O11P2.C2H4O2/c1-5(9)15-20(13,16-6(2)10)19-21(14,17-7(3)11)18-8(4)12;1-2(3)4/h1-4H3;1H3,(H,3,4) |
| InChIKey | FKTVPLCRCAGTCG-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 185.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate?
The IUPAC name of acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate (CID 88649282) is acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate.
What is the SMILES notation for acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate?
The canonical SMILES for acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate is CC(=O)O.CC(=O)OP(=O)(OC(C)=O)OP(=O)(OC(C)=O)OC(C)=O.
What is the InChIKey of acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate?
The InChIKey is FKTVPLCRCAGTCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O11P2.C2H4O2/c1-5(9)15-20(13,16-6(2)10)19-21(14,17-7(3)11)18-8(4)12;1-2(3)4/h1-4H3;1H3,(H,3,4).
What are the key properties of acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate?
acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate has a molecular weight of 406.17 g/mol, XLogP of 1.56, 6 rotatable bonds, 1 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;[acetyloxy(diacetyloxyphosphoryloxy)phosphoryl] acetate is sourced from PubChem (CID 88649282), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).