About ditert-butylphosphoryl acetate
ditert-butylphosphoryl acetate (PubChem CID 87532460) has the molecular formula C10H21O3P
and a molecular weight of 220.25 g/mol. Its IUPAC name is ditert-butylphosphoryl acetate.
Molecular Properties
| Compound Name | ditert-butylphosphoryl acetate |
| PubChem CID | 87532460 |
| Molecular Formula | C10H21O3P |
| Molecular Weight | 220.25 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | ditert-butylphosphoryl acetate |
| SMILES | CC(=O)OP(=O)(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H21O3P/c1-8(11)13-14(12,9(2,3)4)10(5,6)7/h1-7H3 |
| InChIKey | XQRUNARCRADBFD-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.25 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ditert-butylphosphoryl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butylphosphoryl acetate?
The IUPAC name of ditert-butylphosphoryl acetate (CID 87532460) is ditert-butylphosphoryl acetate.
What is the SMILES notation for ditert-butylphosphoryl acetate?
The canonical SMILES for ditert-butylphosphoryl acetate is CC(=O)OP(=O)(C(C)(C)C)C(C)(C)C.
What is the InChIKey of ditert-butylphosphoryl acetate?
The InChIKey is XQRUNARCRADBFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21O3P/c1-8(11)13-14(12,9(2,3)4)10(5,6)7/h1-7H3.
What are the key properties of ditert-butylphosphoryl acetate?
ditert-butylphosphoryl acetate has a molecular weight of 220.25 g/mol, XLogP of 3.42, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butylphosphoryl acetate is sourced from PubChem (CID 87532460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).