C8H15O9P — CID 175059324
2-hydroxyethyl 5,5-dihydroxy-2-methyl-3-phosphonooxypent-2-enoate (PubChem CID 175059324) has the molecular formula C8H15O9P and a molecular weight of 286.17 g/mol. Its IUPAC name is 2-hydroxyethyl 5,5-dihydroxy-2-methyl-3-phosphonooxypent-2-enoate.
| Compound Name | 2-hydroxyethyl 5,5-dihydroxy-2-methyl-3-phosphonooxypent-2-enoate |
|---|---|
| PubChem CID | 175059324 |
| Molecular Formula | C8H15O9P |
| Molecular Weight | 286.17 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 2-hydroxyethyl 5,5-dihydroxy-2-methyl-3-phosphonooxypent-2-enoate |
| SMILES | CC(C(=O)OCCO)=C(CC(O)O)OP(=O)(O)O |
| InChI | InChI=1S/C8H15O9P/c1-5(8(12)16-3-2-9)6(4-7(10)11)17-18(13,14)15/h7,9-11H,2-4H2,1H3,(H2,13,14,15) |
| InChIKey | UEUGAHBWLXLMFU-UHFFFAOYSA-N |
| XLogP | -1.39 |
| TPSA | 153.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.17 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|