C15H28O4 — CID 91296121
3,4-dimethylpent-3-en-1-ol;2-hydroxyethyl 2,3-dimethylbut-2-enoate (PubChem CID 91296121) has the molecular formula C15H28O4 and a molecular weight of 272.39 g/mol. Its IUPAC name is 3,4-dimethylpent-3-en-1-ol;2-hydroxyethyl 2,3-dimethylbut-2-enoate.
| Compound Name | 3,4-dimethylpent-3-en-1-ol;2-hydroxyethyl 2,3-dimethylbut-2-enoate |
|---|---|
| PubChem CID | 91296121 |
| Molecular Formula | C15H28O4 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 3,4-dimethylpent-3-en-1-ol;2-hydroxyethyl 2,3-dimethylbut-2-enoate |
| SMILES | CC(C)=C(C)C(=O)OCCO.CC(C)=C(C)CCO |
| InChI | InChI=1S/C8H14O3.C7H14O/c1-6(2)7(3)8(10)11-5-4-9;1-6(2)7(3)4-5-8/h9H,4-5H2,1-3H3;8H,4-5H2,1-3H3 |
| InChIKey | BAZXXZJLYOTQAO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|