C11H17O7P — CID 151668958
2,2-bis(2-methylprop-2-enoyloxy)ethoxy-methylphosphinic acid (PubChem CID 151668958) has the molecular formula C11H17O7P and a molecular weight of 292.22 g/mol. Its IUPAC name is 2,2-bis(2-methylprop-2-enoyloxy)ethoxy-methylphosphinic acid.
| Compound Name | 2,2-bis(2-methylprop-2-enoyloxy)ethoxy-methylphosphinic acid |
|---|---|
| PubChem CID | 151668958 |
| Molecular Formula | C11H17O7P |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | 2,2-bis(2-methylprop-2-enoyloxy)ethoxy-methylphosphinic acid |
| SMILES | C=C(C)C(=O)OC(COP(C)(=O)O)OC(=O)C(=C)C |
| InChI | InChI=1S/C11H17O7P/c1-7(2)10(12)17-9(6-16-19(5,14)15)18-11(13)8(3)4/h9H,1,3,6H2,2,4-5H3,(H,14,15) |
| InChIKey | QYCXKPHCBBHEAR-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|