C8H13O5P — CID 174524119
2-(2-methylprop-2-enoyloxy)but-3-enylphosphonic acid (PubChem CID 174524119) has the molecular formula C8H13O5P and a molecular weight of 220.16 g/mol. Its IUPAC name is 2-(2-methylprop-2-enoyloxy)but-3-enylphosphonic acid.
| Compound Name | 2-(2-methylprop-2-enoyloxy)but-3-enylphosphonic acid |
|---|---|
| PubChem CID | 174524119 |
| Molecular Formula | C8H13O5P |
| Molecular Weight | 220.16 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(2-methylprop-2-enoyloxy)but-3-enylphosphonic acid |
| SMILES | C=CC(CP(=O)(O)O)OC(=O)C(=C)C |
| InChI | InChI=1S/C8H13O5P/c1-4-7(5-14(10,11)12)13-8(9)6(2)3/h4,7H,1-2,5H2,3H3,(H2,10,11,12) |
| InChIKey | MAGXREJPPLVVFP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|