C9H17O6P — CID 141037886
1-phosphonooxypentan-2-yl 2-methylprop-2-enoate (PubChem CID 141037886) has the molecular formula C9H17O6P and a molecular weight of 252.20 g/mol. Its IUPAC name is 1-phosphonooxypentan-2-yl 2-methylprop-2-enoate.
| Compound Name | 1-phosphonooxypentan-2-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 141037886 |
| Molecular Formula | C9H17O6P |
| Molecular Weight | 252.20 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 1-phosphonooxypentan-2-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCC)COP(=O)(O)O |
| InChI | InChI=1S/C9H17O6P/c1-4-5-8(6-14-16(11,12)13)15-9(10)7(2)3/h8H,2,4-6H2,1,3H3,(H2,11,12,13) |
| InChIKey | NSUCRNIWYRNSAN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.20 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|