C14H27O6P — CID 90186290
(4-ethyl-1-phosphonooxyoctan-2-yl) 2-methylprop-2-enoate (PubChem CID 90186290) has the molecular formula C14H27O6P and a molecular weight of 322.34 g/mol. Its IUPAC name is (4-ethyl-1-phosphonooxyoctan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (4-ethyl-1-phosphonooxyoctan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 90186290 |
| Molecular Formula | C14H27O6P |
| Molecular Weight | 322.34 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | (4-ethyl-1-phosphonooxyoctan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COP(=O)(O)O)CC(CC)CCCC |
| InChI | InChI=1S/C14H27O6P/c1-5-7-8-12(6-2)9-13(10-19-21(16,17)18)20-14(15)11(3)4/h12-13H,3,5-10H2,1-2,4H3,(H2,16,17,18) |
| InChIKey | HVOXTDLXNUABKF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.34 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|