C8H19K2O4P — CID 131883274
CID 131883274 (PubChem CID 131883274) has the molecular formula C8H19K2O4P and a molecular weight of 288.41 g/mol.
| Compound Name | CID 131883274 |
|---|---|
| PubChem CID | 131883274 |
| Molecular Formula | C8H19K2O4P |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | — |
| SMILES | CCCCC(CC)COP(=O)(O)O.[K].[K] |
| InChI | InChI=1S/C8H19O4P.2K/c1-3-5-6-8(4-2)7-12-13(9,10)11;;/h8H,3-7H2,1-2H3,(H2,9,10,11);; |
| InChIKey | IQJSBEUGIFFLDV-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|