About bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate
bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate (PubChem CID 16704221) has the molecular formula C48H102InO12P3
and a molecular weight of 1079.07 g/mol. Its IUPAC name is bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate.
Molecular Properties
| Compound Name | bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate |
| PubChem CID | 16704221 |
| Molecular Formula | C48H102InO12P3 |
| Molecular Weight | 1079.07 g/mol |
| Exact Mass | 1078.56 |
| IUPAC Name | bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate |
| SMILES | CCCCC(CC)COP(=O)(OCC(CC)CCCC)O[In](OP(=O)(OCC(CC)CCCC)OCC(CC)CCCC)OP(=O)(OCC(CC)CCCC)OCC(CC)CCCC |
| InChI | InChI=1S/3C16H35O4P.In/c3*1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2;/h3*15-16H,5-14H2,1-4H3,(H,17,18);/q;;;+3/p-3 |
| InChIKey | BKAJXNYECYHVMY-UHFFFAOYSA-K |
| XLogP | 17.74 |
| TPSA | 134.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 48 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1079.07 |
| LogP ≤ 5 | 17.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate?
The IUPAC name of bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate (CID 16704221) is bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate.
What is the SMILES notation for bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate?
The canonical SMILES for bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate is CCCCC(CC)COP(=O)(OCC(CC)CCCC)O[In](OP(=O)(OCC(CC)CCCC)OCC(CC)CCCC)OP(=O)(OCC(CC)CCCC)OCC(CC)CCCC.
What is the InChIKey of bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate?
The InChIKey is BKAJXNYECYHVMY-UHFFFAOYSA-K. The full InChI is InChI=1S/3C16H35O4P.In/c3*1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2;/h3*15-16H,5-14H2,1-4H3,(H,17,18);/q;;;+3/p-3.
What are the key properties of bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate?
bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate has a molecular weight of 1079.07 g/mol, XLogP of 17.74, 48 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for bis[bis(2-ethylhexoxy)phosphoryloxy]indiganyl bis(2-ethylhexyl) phosphate is sourced from PubChem (CID 16704221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).