C16H31O8P — CID 174752155
(4,4-dibutoxy-1-phosphonooxybutan-2-yl) 2-methylprop-2-enoate (PubChem CID 174752155) has the molecular formula C16H31O8P and a molecular weight of 382.39 g/mol. Its IUPAC name is (4,4-dibutoxy-1-phosphonooxybutan-2-yl) 2-methylprop-2-enoate.
| Compound Name | (4,4-dibutoxy-1-phosphonooxybutan-2-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174752155 |
| Molecular Formula | C16H31O8P |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (4,4-dibutoxy-1-phosphonooxybutan-2-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(COP(=O)(O)O)CC(OCCCC)OCCCC |
| InChI | InChI=1S/C16H31O8P/c1-5-7-9-21-15(22-10-8-6-2)11-14(12-23-25(18,19)20)24-16(17)13(3)4/h14-15H,3,5-12H2,1-2,4H3,(H2,18,19,20) |
| InChIKey | JJZYOMVUACFNHF-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|