C22H43O6P — CID 139937953
2-[bis(2-ethylhexoxy)phosphoryloxy]ethyl 2-methylprop-2-enoate (PubChem CID 139937953) has the molecular formula C22H43O6P and a molecular weight of 434.55 g/mol. Its IUPAC name is 2-[bis(2-ethylhexoxy)phosphoryloxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[bis(2-ethylhexoxy)phosphoryloxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139937953 |
| Molecular Formula | C22H43O6P |
| Molecular Weight | 434.55 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | 2-[bis(2-ethylhexoxy)phosphoryloxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOP(=O)(OCC(CC)CCCC)OCC(CC)CCCC |
| InChI | InChI=1S/C22H43O6P/c1-7-11-13-20(9-3)17-27-29(24,26-16-15-25-22(23)19(5)6)28-18-21(10-4)14-12-8-2/h20-21H,5,7-18H2,1-4,6H3 |
| InChIKey | RXVCHIOCGZJLFI-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.55 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|