C24H46F3O6P — CID 174433357
bis(2-ethylhexyl) hydrogen phosphate;ethene;2,2,2-trifluoroethyl 2-methylprop-2-enoate (PubChem CID 174433357) has the molecular formula C24H46F3O6P and a molecular weight of 518.59 g/mol. Its IUPAC name is bis(2-ethylhexyl) hydrogen phosphate;ethene;2,2,2-trifluoroethyl 2-methylprop-2-enoate.
| Compound Name | bis(2-ethylhexyl) hydrogen phosphate;ethene;2,2,2-trifluoroethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174433357 |
| Molecular Formula | C24H46F3O6P |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | bis(2-ethylhexyl) hydrogen phosphate;ethene;2,2,2-trifluoroethyl 2-methylprop-2-enoate |
| SMILES | C=C.C=C(C)C(=O)OCC(F)(F)F.CCCCC(CC)COP(=O)(O)OCC(CC)CCCC |
| InChI | InChI=1S/C16H35O4P.C6H7F3O2.C2H4/c1-5-9-11-15(7-3)13-19-21(17,18)20-14-16(8-4)12-10-6-2;1-4(2)5(10)11-3-6(7,8)9;1-2/h15-16H,5-14H2,1-4H3,(H,17,18);1,3H2,2H3;1-2H2 |
| InChIKey | UOPAJXXHXYCRLG-UHFFFAOYSA-N |
| XLogP | 8.02 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 8.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|