About (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium
(2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium (PubChem CID 87247999) has the molecular formula C10H18NO3+
and a molecular weight of 200.26 g/mol. Its IUPAC name is (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium.
Molecular Properties
| Compound Name | (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium |
| PubChem CID | 87247999 |
| Molecular Formula | C10H18NO3+ |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium |
| SMILES | C=C(C)C(=O)C(=O)C(O)C[N+](C)(C)C |
| InChI | InChI=1S/C10H18NO3/c1-7(2)9(13)10(14)8(12)6-11(3,4)5/h8,12H,1,6H2,2-5H3/q+1 |
| InChIKey | LBPNRLAHACCHAZ-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium?
The IUPAC name of (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium (CID 87247999) is (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium.
What is the SMILES notation for (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium?
The canonical SMILES for (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium is C=C(C)C(=O)C(=O)C(O)C[N+](C)(C)C.
What is the InChIKey of (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium?
The InChIKey is LBPNRLAHACCHAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18NO3/c1-7(2)9(13)10(14)8(12)6-11(3,4)5/h8,12H,1,6H2,2-5H3/q+1.
What are the key properties of (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium?
(2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium has a molecular weight of 200.26 g/mol, XLogP of -0.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-hydroxy-5-methyl-3,4-dioxohex-5-enyl)-trimethylazanium is sourced from PubChem (CID 87247999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).