C10H18NO2+ — CID 19367479
trimethyl-(5-methyl-3,4-dioxohex-5-enyl)azanium (PubChem CID 19367479) has the molecular formula C10H18NO2+ and a molecular weight of 184.26 g/mol. Its IUPAC name is trimethyl-(5-methyl-3,4-dioxohex-5-enyl)azanium.
| Compound Name | trimethyl-(5-methyl-3,4-dioxohex-5-enyl)azanium |
|---|---|
| PubChem CID | 19367479 |
| Molecular Formula | C10H18NO2+ |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | trimethyl-(5-methyl-3,4-dioxohex-5-enyl)azanium |
| SMILES | C=C(C)C(=O)C(=O)CC[N+](C)(C)C |
| InChI | InChI=1S/C10H18NO2/c1-8(2)10(13)9(12)6-7-11(3,4)5/h1,6-7H2,2-5H3/q+1 |
| InChIKey | WLWNFXJRANPDMR-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|