2-amino-8-methyl-6,7-dioxonon-8-enoic acid

C10H15NO4 — CID 58271873

IUPAC2-amino-8-methyl-6,7-dioxonon-8-enoic acid
SMILESC=C(C)C(=O)C(=O)CCCC(N)C(=O)O
InChIInChI=1S/C10H15NO4/c1-6(2)9(13)8(12)5-3-4-7(11)10(14)15/h7H,1,3-5,11H2,2H3,(H,14,15)
InChIKeyYIIYVGXJXVGUBZ-UHFFFAOYSA-N
MW213.23 g/mol
LogP0.28
Rot. Bonds7

About 2-amino-8-methyl-6,7-dioxonon-8-enoic acid

2-amino-8-methyl-6,7-dioxonon-8-enoic acid (PubChem CID 58271873) has the molecular formula C10H15NO4 and a molecular weight of 213.23 g/mol. Its IUPAC name is 2-amino-8-methyl-6,7-dioxonon-8-enoic acid.

Molecular Properties

Compound Name2-amino-8-methyl-6,7-dioxonon-8-enoic acid
PubChem CID58271873
Molecular FormulaC10H15NO4
Molecular Weight213.23 g/mol
Exact Mass213.10
IUPAC Name2-amino-8-methyl-6,7-dioxonon-8-enoic acid
SMILESC=C(C)C(=O)C(=O)CCCC(N)C(=O)O
InChIInChI=1S/C10H15NO4/c1-6(2)9(13)8(12)5-3-4-7(11)10(14)15/h7H,1,3-5,11H2,2H3,(H,14,15)
InChIKeyYIIYVGXJXVGUBZ-UHFFFAOYSA-N
XLogP0.28
TPSA97.46 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.23
LogP ≤ 50.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 2-amino-8-methyl-6,7-dioxonon-8-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-amino-8-methyl-6,7-dioxonon-8-enoic acid?
The IUPAC name of 2-amino-8-methyl-6,7-dioxonon-8-enoic acid (CID 58271873) is 2-amino-8-methyl-6,7-dioxonon-8-enoic acid.
What is the SMILES notation for 2-amino-8-methyl-6,7-dioxonon-8-enoic acid?
The canonical SMILES for 2-amino-8-methyl-6,7-dioxonon-8-enoic acid is C=C(C)C(=O)C(=O)CCCC(N)C(=O)O.
What is the InChIKey of 2-amino-8-methyl-6,7-dioxonon-8-enoic acid?
The InChIKey is YIIYVGXJXVGUBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NO4/c1-6(2)9(13)8(12)5-3-4-7(11)10(14)15/h7H,1,3-5,11H2,2H3,(H,14,15).
What are the key properties of 2-amino-8-methyl-6,7-dioxonon-8-enoic acid?
2-amino-8-methyl-6,7-dioxonon-8-enoic acid has a molecular weight of 213.23 g/mol, XLogP of 0.28, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-8-methyl-6,7-dioxonon-8-enoic acid is sourced from PubChem (CID 58271873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).