C10H15NO5 — CID 59658358
2-amino-7,8,9-trioxodecanoic acid (PubChem CID 59658358) has the molecular formula C10H15NO5 and a molecular weight of 229.23 g/mol. Its IUPAC name is 2-amino-7,8,9-trioxodecanoic acid.
| Compound Name | 2-amino-7,8,9-trioxodecanoic acid |
|---|---|
| PubChem CID | 59658358 |
| Molecular Formula | C10H15NO5 |
| Molecular Weight | 229.23 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | 2-amino-7,8,9-trioxodecanoic acid |
| SMILES | CC(=O)C(=O)C(=O)CCCCC(N)C(=O)O |
| InChI | InChI=1S/C10H15NO5/c1-6(12)9(14)8(13)5-3-2-4-7(11)10(15)16/h7H,2-5,11H2,1H3,(H,15,16) |
| InChIKey | JIKJTIJQVHNLGJ-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 114.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|