C8H11ClO2 — CID 175134675
5-chloro-2-methylhept-1-ene-3,4-dione (PubChem CID 175134675) has the molecular formula C8H11ClO2 and a molecular weight of 174.63 g/mol. Its IUPAC name is 5-chloro-2-methylhept-1-ene-3,4-dione.
| Compound Name | 5-chloro-2-methylhept-1-ene-3,4-dione |
|---|---|
| PubChem CID | 175134675 |
| Molecular Formula | C8H11ClO2 |
| Molecular Weight | 174.63 g/mol |
| Exact Mass | 174.04 |
| IUPAC Name | 5-chloro-2-methylhept-1-ene-3,4-dione |
| SMILES | C=C(C)C(=O)C(=O)C(Cl)CC |
| InChI | InChI=1S/C8H11ClO2/c1-4-6(9)8(11)7(10)5(2)3/h6H,2,4H2,1,3H3 |
| InChIKey | VTCVUUXXROKLNH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|