About 1,1-dichloropropane;propan-2-one
1,1-dichloropropane;propan-2-one (PubChem CID 174776719) has the molecular formula C6H12Cl2O
and a molecular weight of 171.07 g/mol. Its IUPAC name is 1,1-dichloropropane;propan-2-one.
Molecular Properties
| Compound Name | 1,1-dichloropropane;propan-2-one |
| PubChem CID | 174776719 |
| Molecular Formula | C6H12Cl2O |
| Molecular Weight | 171.07 g/mol |
| Exact Mass | 170.03 |
| IUPAC Name | 1,1-dichloropropane;propan-2-one |
| SMILES | CC(C)=O.CCC(Cl)Cl |
| InChI | InChI=1S/C3H6Cl2.C3H6O/c1-2-3(4)5;1-3(2)4/h3H,2H2,1H3;1-2H3 |
| InChIKey | RFIWVKOFLYJKKH-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.07 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dichloropropane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dichloropropane;propan-2-one?
The IUPAC name of 1,1-dichloropropane;propan-2-one (CID 174776719) is 1,1-dichloropropane;propan-2-one.
What is the SMILES notation for 1,1-dichloropropane;propan-2-one?
The canonical SMILES for 1,1-dichloropropane;propan-2-one is CC(C)=O.CCC(Cl)Cl.
What is the InChIKey of 1,1-dichloropropane;propan-2-one?
The InChIKey is RFIWVKOFLYJKKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Cl2.C3H6O/c1-2-3(4)5;1-3(2)4/h3H,2H2,1H3;1-2H3.
What are the key properties of 1,1-dichloropropane;propan-2-one?
1,1-dichloropropane;propan-2-one has a molecular weight of 171.07 g/mol, XLogP of 2.80, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dichloropropane;propan-2-one is sourced from PubChem (CID 174776719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).