C7H12Cl2OSn — CID 71393770
5,5-Dichloro-3-ethylpentan-2-one--lambda~2~-stannane (1/1) (PubChem CID 71393770) has the molecular formula C7H12Cl2OSn and a molecular weight of 301.79 g/mol.
| Compound Name | 5,5-Dichloro-3-ethylpentan-2-one--lambda~2~-stannane (1/1) |
|---|---|
| PubChem CID | 71393770 |
| Molecular Formula | C7H12Cl2OSn |
| Molecular Weight | 301.79 g/mol |
| Exact Mass | 301.93 |
| IUPAC Name | — |
| SMILES | CCC(CC(Cl)Cl)C(C)=O.[Sn] |
| InChI | InChI=1S/C7H12Cl2O.Sn/c1-3-6(5(2)10)4-7(8)9;/h6-7H,3-4H2,1-2H3; |
| InChIKey | LZMXTPZUXMIKHY-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.79 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|