C6H11O5P — CID 88853042
(2-hydroxy-4-methyl-3-oxopent-4-enyl)phosphonic acid (PubChem CID 88853042) has the molecular formula C6H11O5P and a molecular weight of 194.12 g/mol. Its IUPAC name is (2-hydroxy-4-methyl-3-oxopent-4-enyl)phosphonic acid.
| Compound Name | (2-hydroxy-4-methyl-3-oxopent-4-enyl)phosphonic acid |
|---|---|
| PubChem CID | 88853042 |
| Molecular Formula | C6H11O5P |
| Molecular Weight | 194.12 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | (2-hydroxy-4-methyl-3-oxopent-4-enyl)phosphonic acid |
| SMILES | C=C(C)C(=O)C(O)CP(=O)(O)O |
| InChI | InChI=1S/C6H11O5P/c1-4(2)6(8)5(7)3-12(9,10)11/h5,7H,1,3H2,2H3,(H2,9,10,11) |
| InChIKey | BRTJBUWWBCJUAF-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.12 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|