C11H16O5 — CID 22245213
4,5,6-trihydroxy-2,8-dimethylnona-1,8-diene-3,7-dione (PubChem CID 22245213) has the molecular formula C11H16O5 and a molecular weight of 228.24 g/mol. Its IUPAC name is 4,5,6-trihydroxy-2,8-dimethylnona-1,8-diene-3,7-dione.
| Compound Name | 4,5,6-trihydroxy-2,8-dimethylnona-1,8-diene-3,7-dione |
|---|---|
| PubChem CID | 22245213 |
| Molecular Formula | C11H16O5 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 4,5,6-trihydroxy-2,8-dimethylnona-1,8-diene-3,7-dione |
| SMILES | C=C(C)C(=O)C(O)C(O)C(O)C(=O)C(=C)C |
| InChI | InChI=1S/C11H16O5/c1-5(2)7(12)9(14)11(16)10(15)8(13)6(3)4/h9-11,14-16H,1,3H2,2,4H3 |
| InChIKey | WKXVNGPFLMTDNL-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|