C8H12O8 — CID 23517313
(2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6,7-dioxooctanoic acid (PubChem CID 23517313) has the molecular formula C8H12O8 and a molecular weight of 236.18 g/mol. Its IUPAC name is (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6,7-dioxooctanoic acid.
| Compound Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6,7-dioxooctanoic acid |
|---|---|
| PubChem CID | 23517313 |
| Molecular Formula | C8H12O8 |
| Molecular Weight | 236.18 g/mol |
| Exact Mass | 236.05 |
| IUPAC Name | (2S,3R,4S,5R)-2,3,4,5-tetrahydroxy-6,7-dioxooctanoic acid |
| SMILES | CC(=O)C(=O)[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C(=O)O |
| InChI | InChI=1S/C8H12O8/c1-2(9)3(10)4(11)5(12)6(13)7(14)8(15)16/h4-7,11-14H,1H3,(H,15,16)/t4-,5+,6+,7-/m0/s1 |
| InChIKey | KNFZEFUDYBVCQP-WNJXEPBRSA-N |
| XLogP | -3.33 |
| TPSA | 152.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.18 |
| LogP ≤ 5 | -3.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|