(2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid

C6H8O8 — CID 13295408

IUPAC(2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid
SMILESO=C(O)C(=O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O
InChIInChI=1S/C6H8O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-3,7-9H,(H,11,12)(H,13,14)/t1-,2-,3+/m0/s1
InChIKeyIUQNAGFJAIOCNL-XZIMBLGRSA-N
MW208.12 g/mol
LogP-3.19
Rot. Bonds5

About (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid

(2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid (PubChem CID 13295408) has the molecular formula C6H8O8 and a molecular weight of 208.12 g/mol. Its IUPAC name is (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid.

Molecular Properties

Compound Name(2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid
PubChem CID13295408
Molecular FormulaC6H8O8
Molecular Weight208.12 g/mol
Exact Mass208.02
IUPAC Name(2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid
SMILESO=C(O)C(=O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O
InChIInChI=1S/C6H8O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-3,7-9H,(H,11,12)(H,13,14)/t1-,2-,3+/m0/s1
InChIKeyIUQNAGFJAIOCNL-XZIMBLGRSA-N
XLogP-3.19
TPSA152.36 Ų
H-Bond Donors5
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500208.12
LogP ≤ 5-3.19
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 106

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'diketo_group', 'substructure': 'N/A'}

Analyze (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid?
The IUPAC name of (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid (CID 13295408) is (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid.
What is the SMILES notation for (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid?
The canonical SMILES for (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid is O=C(O)C(=O)[C@@H](O)[C@H](O)[C@@H](O)C(=O)O.
What is the InChIKey of (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid?
The InChIKey is IUQNAGFJAIOCNL-XZIMBLGRSA-N. The full InChI is InChI=1S/C6H8O8/c7-1(3(9)5(11)12)2(8)4(10)6(13)14/h1-3,7-9H,(H,11,12)(H,13,14)/t1-,2-,3+/m0/s1.
What are the key properties of (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid?
(2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid has a molecular weight of 208.12 g/mol, XLogP of -3.19, 5 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S,4S)-2,3,4-trihydroxy-5-oxohexanedioic acid is sourced from PubChem (CID 13295408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).