C13H27NO6P+ — CID 174959993
4-[hydroxy-(2-hydroxy-4-methyl-3-oxopent-4-enoxy)phosphoryl]oxybutyl-trimethylazanium (PubChem CID 174959993) has the molecular formula C13H27NO6P+ and a molecular weight of 324.33 g/mol. Its IUPAC name is 4-[hydroxy-(2-hydroxy-4-methyl-3-oxopent-4-enoxy)phosphoryl]oxybutyl-trimethylazanium.
| Compound Name | 4-[hydroxy-(2-hydroxy-4-methyl-3-oxopent-4-enoxy)phosphoryl]oxybutyl-trimethylazanium |
|---|---|
| PubChem CID | 174959993 |
| Molecular Formula | C13H27NO6P+ |
| Molecular Weight | 324.33 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-[hydroxy-(2-hydroxy-4-methyl-3-oxopent-4-enoxy)phosphoryl]oxybutyl-trimethylazanium |
| SMILES | C=C(C)C(=O)C(O)COP(=O)(O)OCCCC[N+](C)(C)C |
| InChI | InChI=1S/C13H26NO6P/c1-11(2)13(16)12(15)10-20-21(17,18)19-9-7-6-8-14(3,4)5/h12,15H,1,6-10H2,2-5H3/p+1 |
| InChIKey | SAHYGNVVUJRTBA-UHFFFAOYSA-O |
| XLogP | 1.11 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|