C45H57O16P — CID 139672809
tris[5-(hydroxymethyl)-2,7-dimethyl-4-(2-methylprop-2-enoyl)-3,6-dioxoocta-1,7-dien-4-yl] phosphate (PubChem CID 139672809) has the molecular formula C45H57O16P and a molecular weight of 884.91 g/mol. Its IUPAC name is tris[5-(hydroxymethyl)-2,7-dimethyl-4-(2-methylprop-2-enoyl)-3,6-dioxoocta-1,7-dien-4-yl] phosphate.
| Compound Name | tris[5-(hydroxymethyl)-2,7-dimethyl-4-(2-methylprop-2-enoyl)-3,6-dioxoocta-1,7-dien-4-yl] phosphate |
|---|---|
| PubChem CID | 139672809 |
| Molecular Formula | C45H57O16P |
| Molecular Weight | 884.91 g/mol |
| Exact Mass | 884.34 |
| IUPAC Name | tris[5-(hydroxymethyl)-2,7-dimethyl-4-(2-methylprop-2-enoyl)-3,6-dioxoocta-1,7-dien-4-yl] phosphate |
| SMILES | C=C(C)C(=O)C(CO)C(OP(=O)(OC(C(=O)C(=C)C)(C(=O)C(=C)C)C(CO)C(=O)C(=C)C)OC(C(=O)C(=C)C)(C(=O)C(=C)C)C(CO)C(=O)C(=C)C)(C(=O)C(=C)C)C(=O)C(=C)C |
| InChI | InChI=1S/C45H57O16P/c1-22(2)34(49)31(19-46)43(37(52)25(7)8,38(53)26(9)10)59-62(58,60-44(39(54)27(11)12,40(55)28(13)14)32(20-47)35(50)23(3)4)61-45(41(56)29(15)16,42(57)30(17)18)33(21-48)36(51)24(5)6/h31-33,46-48H,1,3,5,7,9,11,13,15,17,19-21H2,2,4,6,8,10,12,14,16,18H3 |
| InChIKey | INOUZFGJTDSETD-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 259.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.91 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|