C13H25O6P — CID 89426238
[4-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-2-methylbutan-2-yl] dihydrogen phosphate (PubChem CID 89426238) has the molecular formula C13H25O6P and a molecular weight of 308.31 g/mol. Its IUPAC name is [4-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-2-methylbutan-2-yl] dihydrogen phosphate.
| Compound Name | [4-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-2-methylbutan-2-yl] dihydrogen phosphate |
|---|---|
| PubChem CID | 89426238 |
| Molecular Formula | C13H25O6P |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | [4-(3,5-dimethyl-4-oxohex-5-en-3-yl)oxy-2-methylbutan-2-yl] dihydrogen phosphate |
| SMILES | C=C(C)C(=O)C(C)(CC)OCCC(C)(C)OP(=O)(O)O |
| InChI | InChI=1S/C13H25O6P/c1-7-13(6,11(14)10(2)3)18-9-8-12(4,5)19-20(15,16)17/h2,7-9H2,1,3-6H3,(H2,15,16,17) |
| InChIKey | HTZUDNUBCLEJAE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|