C14H23O8P — CID 88595404
[1-(2-methylprop-2-enoyloxy)-1-phosphonooxyhexyl] 2-methylprop-2-enoate (PubChem CID 88595404) has the molecular formula C14H23O8P and a molecular weight of 350.30 g/mol. Its IUPAC name is [1-(2-methylprop-2-enoyloxy)-1-phosphonooxyhexyl] 2-methylprop-2-enoate.
| Compound Name | [1-(2-methylprop-2-enoyloxy)-1-phosphonooxyhexyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 88595404 |
| Molecular Formula | C14H23O8P |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | [1-(2-methylprop-2-enoyloxy)-1-phosphonooxyhexyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CCCCC)(OC(=O)C(=C)C)OP(=O)(O)O |
| InChI | InChI=1S/C14H23O8P/c1-6-7-8-9-14(22-23(17,18)19,20-12(15)10(2)3)21-13(16)11(4)5/h2,4,6-9H2,1,3,5H3,(H2,17,18,19) |
| InChIKey | BISXETBHALTQGQ-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|