C10H19O6P — CID 87476353
3-(phosphonooxymethyl)pentan-3-yl 2-methylprop-2-enoate (PubChem CID 87476353) has the molecular formula C10H19O6P and a molecular weight of 266.23 g/mol. Its IUPAC name is 3-(phosphonooxymethyl)pentan-3-yl 2-methylprop-2-enoate.
| Compound Name | 3-(phosphonooxymethyl)pentan-3-yl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 87476353 |
| Molecular Formula | C10H19O6P |
| Molecular Weight | 266.23 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 3-(phosphonooxymethyl)pentan-3-yl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(CC)(CC)COP(=O)(O)O |
| InChI | InChI=1S/C10H19O6P/c1-5-10(6-2,7-15-17(12,13)14)16-9(11)8(3)4/h3,5-7H2,1-2,4H3,(H2,12,13,14) |
| InChIKey | PTURIHZNBDFIFM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.23 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|