C15H19O12P — CID 23084523
2-methylprop-2-enoic acid;[2-phosphonooxy-1,1-di(prop-2-enoyloxy)ethyl] prop-2-enoate (PubChem CID 23084523) has the molecular formula C15H19O12P and a molecular weight of 422.28 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;[2-phosphonooxy-1,1-di(prop-2-enoyloxy)ethyl] prop-2-enoate.
| Compound Name | 2-methylprop-2-enoic acid;[2-phosphonooxy-1,1-di(prop-2-enoyloxy)ethyl] prop-2-enoate |
|---|---|
| PubChem CID | 23084523 |
| Molecular Formula | C15H19O12P |
| Molecular Weight | 422.28 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 2-methylprop-2-enoic acid;[2-phosphonooxy-1,1-di(prop-2-enoyloxy)ethyl] prop-2-enoate |
| SMILES | C=C(C)C(=O)O.C=CC(=O)OC(COP(=O)(O)O)(OC(=O)C=C)OC(=O)C=C |
| InChI | InChI=1S/C11H13O10P.C4H6O2/c1-4-8(12)19-11(20-9(13)5-2,21-10(14)6-3)7-18-22(15,16)17;1-3(2)4(5)6/h4-6H,1-3,7H2,(H2,15,16,17);1H2,2H3,(H,5,6) |
| InChIKey | SVXIVRRRUYPZJQ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 182.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|