C14H26O2 — CID 139387369
2,5,5-trimethyl-7-[(2-methylpropan-2-yl)oxy]hept-1-en-3-one (PubChem CID 139387369) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is 2,5,5-trimethyl-7-[(2-methylpropan-2-yl)oxy]hept-1-en-3-one.
| Compound Name | 2,5,5-trimethyl-7-[(2-methylpropan-2-yl)oxy]hept-1-en-3-one |
|---|---|
| PubChem CID | 139387369 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | 2,5,5-trimethyl-7-[(2-methylpropan-2-yl)oxy]hept-1-en-3-one |
| SMILES | C=C(C)C(=O)CC(C)(C)CCOC(C)(C)C |
| InChI | InChI=1S/C14H26O2/c1-11(2)12(15)10-14(6,7)8-9-16-13(3,4)5/h1,8-10H2,2-7H3 |
| InChIKey | CXJYDCNLTBWKBJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|