C11H23NO2 — CID 123807188
N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]acetamide (PubChem CID 123807188) has the molecular formula C11H23NO2 and a molecular weight of 201.31 g/mol. Its IUPAC name is N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]acetamide.
| Compound Name | N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]acetamide |
|---|---|
| PubChem CID | 123807188 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | N-[2-methyl-4-[(2-methylpropan-2-yl)oxy]butan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)CCOC(C)(C)C |
| InChI | InChI=1S/C11H23NO2/c1-9(13)12-11(5,6)7-8-14-10(2,3)4/h7-8H2,1-6H3,(H,12,13) |
| InChIKey | UPXWTCICTKNLOP-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |