C16H35NO2 — CID 144742441
N-[2-methyl-4-(2-methylpentan-2-yloxy)butan-2-yl]acetamide;propane (PubChem CID 144742441) has the molecular formula C16H35NO2 and a molecular weight of 273.46 g/mol. Its IUPAC name is N-[2-methyl-4-(2-methylpentan-2-yloxy)butan-2-yl]acetamide;propane.
| Compound Name | N-[2-methyl-4-(2-methylpentan-2-yloxy)butan-2-yl]acetamide;propane |
|---|---|
| PubChem CID | 144742441 |
| Molecular Formula | C16H35NO2 |
| Molecular Weight | 273.46 g/mol |
| Exact Mass | 273.27 |
| IUPAC Name | N-[2-methyl-4-(2-methylpentan-2-yloxy)butan-2-yl]acetamide;propane |
| SMILES | CCC.CCCC(C)(C)OCCC(C)(C)NC(C)=O |
| InChI | InChI=1S/C13H27NO2.C3H8/c1-7-8-13(5,6)16-10-9-12(3,4)14-11(2)15;1-3-2/h7-10H2,1-6H3,(H,14,15);3H2,1-2H3 |
| InChIKey | YHKQDHLIDABKJJ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.46 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |