C25H51NO5 — CID 143784438
N-[4-(4-butoxy-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-2-(3-butoxy-3-methylbutoxy)acetamide (PubChem CID 143784438) has the molecular formula C25H51NO5 and a molecular weight of 445.69 g/mol. Its IUPAC name is N-[4-(4-butoxy-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-2-(3-butoxy-3-methylbutoxy)acetamide.
| Compound Name | N-[4-(4-butoxy-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-2-(3-butoxy-3-methylbutoxy)acetamide |
|---|---|
| PubChem CID | 143784438 |
| Molecular Formula | C25H51NO5 |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.38 |
| IUPAC Name | N-[4-(4-butoxy-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-2-(3-butoxy-3-methylbutoxy)acetamide |
| SMILES | CCCCOCCC(C)(C)OCCC(C)(C)NC(=O)COCCC(C)(C)OCCCC |
| InChI | InChI=1S/C25H51NO5/c1-9-11-16-28-18-14-25(7,8)31-20-13-23(3,4)26-22(27)21-29-19-15-24(5,6)30-17-12-10-2/h9-21H2,1-8H3,(H,26,27) |
| InChIKey | ZTIHCKRUPLBHEL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|