C20H41NO2 — CID 139395323
N-[2-methyl-4-(2-methyl-5-propylnonan-2-yl)oxybutan-2-yl]acetamide (PubChem CID 139395323) has the molecular formula C20H41NO2 and a molecular weight of 327.55 g/mol. Its IUPAC name is N-[2-methyl-4-(2-methyl-5-propylnonan-2-yl)oxybutan-2-yl]acetamide.
| Compound Name | N-[2-methyl-4-(2-methyl-5-propylnonan-2-yl)oxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 139395323 |
| Molecular Formula | C20H41NO2 |
| Molecular Weight | 327.55 g/mol |
| Exact Mass | 327.31 |
| IUPAC Name | N-[2-methyl-4-(2-methyl-5-propylnonan-2-yl)oxybutan-2-yl]acetamide |
| SMILES | CCCCC(CCC)CCC(C)(C)OCCC(C)(C)NC(C)=O |
| InChI | InChI=1S/C20H41NO2/c1-8-10-12-18(11-9-2)13-14-20(6,7)23-16-15-19(4,5)21-17(3)22/h18H,8-16H2,1-7H3,(H,21,22) |
| InChIKey | FMJIGLMTWHTWLJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.55 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |