C18H38N2O2 — CID 162684940
N-[4-[6-(tert-butylamino)-2-methylhexan-2-yl]oxy-2-methylbutan-2-yl]acetamide (PubChem CID 162684940) has the molecular formula C18H38N2O2 and a molecular weight of 314.51 g/mol. Its IUPAC name is N-[4-[6-(tert-butylamino)-2-methylhexan-2-yl]oxy-2-methylbutan-2-yl]acetamide.
| Compound Name | N-[4-[6-(tert-butylamino)-2-methylhexan-2-yl]oxy-2-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 162684940 |
| Molecular Formula | C18H38N2O2 |
| Molecular Weight | 314.51 g/mol |
| Exact Mass | 314.29 |
| IUPAC Name | N-[4-[6-(tert-butylamino)-2-methylhexan-2-yl]oxy-2-methylbutan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)CCOC(C)(C)CCCCNC(C)(C)C |
| InChI | InChI=1S/C18H38N2O2/c1-15(21)20-17(5,6)12-14-22-18(7,8)11-9-10-13-19-16(2,3)4/h19H,9-14H2,1-8H3,(H,20,21) |
| InChIKey | CSDVTSHAKSADGJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.51 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|