C18H37NO2 — CID 146359275
N-[4-(2,5-dimethylnonan-2-yloxy)-2-methylbutan-2-yl]acetamide (PubChem CID 146359275) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is N-[4-(2,5-dimethylnonan-2-yloxy)-2-methylbutan-2-yl]acetamide.
| Compound Name | N-[4-(2,5-dimethylnonan-2-yloxy)-2-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 146359275 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | N-[4-(2,5-dimethylnonan-2-yloxy)-2-methylbutan-2-yl]acetamide |
| SMILES | CCCCC(C)CCC(C)(C)OCCC(C)(C)NC(C)=O |
| InChI | InChI=1S/C18H37NO2/c1-8-9-10-15(2)11-12-18(6,7)21-14-13-17(4,5)19-16(3)20/h15H,8-14H2,1-7H3,(H,19,20) |
| InChIKey | RPHJNXUPNVIXKO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |