C15H31N5O2 — CID 167239906
1-(2-azidoethyl)-3-[2-methyl-4-(2-methylhexan-2-yloxy)butan-2-yl]urea (PubChem CID 167239906) has the molecular formula C15H31N5O2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 1-(2-azidoethyl)-3-[2-methyl-4-(2-methylhexan-2-yloxy)butan-2-yl]urea.
| Compound Name | 1-(2-azidoethyl)-3-[2-methyl-4-(2-methylhexan-2-yloxy)butan-2-yl]urea |
|---|---|
| PubChem CID | 167239906 |
| Molecular Formula | C15H31N5O2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.25 |
| IUPAC Name | 1-(2-azidoethyl)-3-[2-methyl-4-(2-methylhexan-2-yloxy)butan-2-yl]urea |
| SMILES | CCCCC(C)(C)OCCC(C)(C)NC(=O)NCCN=[N+]=[N-] |
| InChI | InChI=1S/C15H31N5O2/c1-6-7-8-15(4,5)22-12-9-14(2,3)19-13(21)17-10-11-18-20-16/h6-12H2,1-5H3,(H2,17,19,21) |
| InChIKey | NNTQNFSZEFBGHO-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|