C12H25IN2O2 — CID 144955514
1-[4-(4-iodo-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-3-methylurea (PubChem CID 144955514) has the molecular formula C12H25IN2O2 and a molecular weight of 356.25 g/mol. Its IUPAC name is 1-[4-(4-iodo-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-3-methylurea.
| Compound Name | 1-[4-(4-iodo-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-3-methylurea |
|---|---|
| PubChem CID | 144955514 |
| Molecular Formula | C12H25IN2O2 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-[4-(4-iodo-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]-3-methylurea |
| SMILES | CNC(=O)NC(C)(C)CCOC(C)(C)CCI |
| InChI | InChI=1S/C12H25IN2O2/c1-11(2,15-10(16)14-5)7-9-17-12(3,4)6-8-13/h6-9H2,1-5H3,(H2,14,15,16) |
| InChIKey | CJBRILKORSWWEC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|