C12H26N2O2 — CID 144960921
N-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]acetamide (PubChem CID 144960921) has the molecular formula C12H26N2O2 and a molecular weight of 230.35 g/mol. Its IUPAC name is N-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]acetamide.
| Compound Name | N-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]acetamide |
|---|---|
| PubChem CID | 144960921 |
| Molecular Formula | C12H26N2O2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | N-[4-(4-amino-2-methylbutan-2-yl)oxy-2-methylbutan-2-yl]acetamide |
| SMILES | CC(=O)NC(C)(C)CCOC(C)(C)CCN |
| InChI | InChI=1S/C12H26N2O2/c1-10(15)14-11(2,3)7-9-16-12(4,5)6-8-13/h6-9,13H2,1-5H3,(H,14,15) |
| InChIKey | SDWAWKKCIQDJJK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |