C11H24N2O3 — CID 175166936
[5-(2-aminoethoxy)-2,5-dimethylhexan-2-yl]carbamic acid (PubChem CID 175166936) has the molecular formula C11H24N2O3 and a molecular weight of 232.32 g/mol. Its IUPAC name is [5-(2-aminoethoxy)-2,5-dimethylhexan-2-yl]carbamic acid.
| Compound Name | [5-(2-aminoethoxy)-2,5-dimethylhexan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175166936 |
| Molecular Formula | C11H24N2O3 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | [5-(2-aminoethoxy)-2,5-dimethylhexan-2-yl]carbamic acid |
| SMILES | CC(C)(CCC(C)(C)OCCN)NC(=O)O |
| InChI | InChI=1S/C11H24N2O3/c1-10(2,13-9(14)15)5-6-11(3,4)16-8-7-12/h13H,5-8,12H2,1-4H3,(H,14,15) |
| InChIKey | LVMHCOBINWSGJY-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |