C11H22N4O2 — CID 166871024
4-(4-azido-2-methylbutan-2-yl)oxy-2,2-dimethylbutanamide (PubChem CID 166871024) has the molecular formula C11H22N4O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 4-(4-azido-2-methylbutan-2-yl)oxy-2,2-dimethylbutanamide.
| Compound Name | 4-(4-azido-2-methylbutan-2-yl)oxy-2,2-dimethylbutanamide |
|---|---|
| PubChem CID | 166871024 |
| Molecular Formula | C11H22N4O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 4-(4-azido-2-methylbutan-2-yl)oxy-2,2-dimethylbutanamide |
| SMILES | CC(C)(CCN=[N+]=[N-])OCCC(C)(C)C(N)=O |
| InChI | InChI=1S/C11H22N4O2/c1-10(2,9(12)16)6-8-17-11(3,4)5-7-14-15-13/h5-8H2,1-4H3,(H2,12,16) |
| InChIKey | TUIRAUWFEANXEY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 101.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|