C7H14N6O2 — CID 123614719
2,2-bis(2-azidoethoxy)propane (PubChem CID 123614719) has the molecular formula C7H14N6O2 and a molecular weight of 214.23 g/mol. Its IUPAC name is 2,2-bis(2-azidoethoxy)propane.
| Compound Name | 2,2-bis(2-azidoethoxy)propane |
|---|---|
| PubChem CID | 123614719 |
| Molecular Formula | C7H14N6O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | 2,2-bis(2-azidoethoxy)propane |
| SMILES | CC(C)(OCCN=[N+]=[N-])OCCN=[N+]=[N-] |
| InChI | InChI=1S/C7H14N6O2/c1-7(2,14-5-3-10-12-8)15-6-4-11-13-9/h3-6H2,1-2H3 |
| InChIKey | ZLVRQWCBYKWRJH-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 115.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|