C22H43N9O8 — CID 59660898
1-[2-(2-azidoethoxy)ethoxy]-2,2-bis[2-(2-azidoethoxy)ethoxymethyl]-3-(2-propoxyethoxy)propane (PubChem CID 59660898) has the molecular formula C22H43N9O8 and a molecular weight of 561.64 g/mol. Its IUPAC name is 1-[2-(2-azidoethoxy)ethoxy]-2,2-bis[2-(2-azidoethoxy)ethoxymethyl]-3-(2-propoxyethoxy)propane.
| Compound Name | 1-[2-(2-azidoethoxy)ethoxy]-2,2-bis[2-(2-azidoethoxy)ethoxymethyl]-3-(2-propoxyethoxy)propane |
|---|---|
| PubChem CID | 59660898 |
| Molecular Formula | C22H43N9O8 |
| Molecular Weight | 561.64 g/mol |
| Exact Mass | 561.32 |
| IUPAC Name | 1-[2-(2-azidoethoxy)ethoxy]-2,2-bis[2-(2-azidoethoxy)ethoxymethyl]-3-(2-propoxyethoxy)propane |
| SMILES | CCCOCCOCC(COCCOCCN=[N+]=[N-])(COCCOCCN=[N+]=[N-])COCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C22H43N9O8/c1-2-6-32-10-14-36-18-22(19-37-15-11-33-7-3-26-29-23,20-38-16-12-34-8-4-27-30-24)21-39-17-13-35-9-5-28-31-25/h2-21H2,1H3 |
| InChIKey | OAUMTIQJPBQMTN-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 220.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.64 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|