About 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol
2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol (PubChem CID 165387139) has the molecular formula C13H26N6O6
and a molecular weight of 362.39 g/mol. Its IUPAC name is 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol.
Molecular Properties
| Compound Name | 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol |
| PubChem CID | 165387139 |
| Molecular Formula | C13H26N6O6 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol |
| SMILES | [N-]=[N+]=NCCOCCOCC(CO)(CO)COCCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C13H26N6O6/c14-18-16-1-3-22-5-7-24-11-13(9-20,10-21)12-25-8-6-23-4-2-17-19-15/h20-21H,1-12H2 |
| InChIKey | PAGBVUWBBHABOC-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 174.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol?
The IUPAC name of 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol (CID 165387139) is 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol.
What is the SMILES notation for 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol?
The canonical SMILES for 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol is [N-]=[N+]=NCCOCCOCC(CO)(CO)COCCOCCN=[N+]=[N-].
What is the InChIKey of 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol?
The InChIKey is PAGBVUWBBHABOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26N6O6/c14-18-16-1-3-22-5-7-24-11-13(9-20,10-21)12-25-8-6-23-4-2-17-19-15/h20-21H,1-12H2.
What are the key properties of 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol?
2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol has a molecular weight of 362.39 g/mol, XLogP of 0.64, 18 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis[2-(2-azidoethoxy)ethoxymethyl]propane-1,3-diol is sourced from PubChem (CID 165387139), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).