C17H32N12O4 — CID 140930764
1,5-bis(2-azidoethoxy)-3,3-bis[2-(2-azidoethoxy)ethyl]pentane (PubChem CID 140930764) has the molecular formula C17H32N12O4 and a molecular weight of 468.52 g/mol. Its IUPAC name is 1,5-bis(2-azidoethoxy)-3,3-bis[2-(2-azidoethoxy)ethyl]pentane.
| Compound Name | 1,5-bis(2-azidoethoxy)-3,3-bis[2-(2-azidoethoxy)ethyl]pentane |
|---|---|
| PubChem CID | 140930764 |
| Molecular Formula | C17H32N12O4 |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.27 |
| IUPAC Name | 1,5-bis(2-azidoethoxy)-3,3-bis[2-(2-azidoethoxy)ethyl]pentane |
| SMILES | [N-]=[N+]=NCCOCCC(CCOCCN=[N+]=[N-])(CCOCCN=[N+]=[N-])CCOCCN=[N+]=[N-] |
| InChI | InChI=1S/C17H32N12O4/c18-26-22-5-13-30-9-1-17(2-10-31-14-6-23-27-19,3-11-32-15-7-24-28-20)4-12-33-16-8-25-29-21/h1-16H2 |
| InChIKey | AUJFWRXXNTVSSZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 231.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|