C10H19NO4 — CID 119187574
2-[(2-butoxyacetyl)amino]-2-methylpropanoic acid (PubChem CID 119187574) has the molecular formula C10H19NO4 and a molecular weight of 217.26 g/mol. Its IUPAC name is 2-[(2-butoxyacetyl)amino]-2-methylpropanoic acid.
| Compound Name | 2-[(2-butoxyacetyl)amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 119187574 |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 g/mol |
| Exact Mass | 217.13 |
| IUPAC Name | 2-[(2-butoxyacetyl)amino]-2-methylpropanoic acid |
| SMILES | CCCCOCC(=O)NC(C)(C)C(=O)O |
| InChI | InChI=1S/C10H19NO4/c1-4-5-6-15-7-8(12)11-10(2,3)9(13)14/h4-7H2,1-3H3,(H,11,12)(H,13,14) |
| InChIKey | LDUHAUXYBKXMND-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.26 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|