C11H23NO3 — CID 103933314
N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-propoxyacetamide (PubChem CID 103933314) has the molecular formula C11H23NO3 and a molecular weight of 217.31 g/mol. Its IUPAC name is N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-propoxyacetamide.
| Compound Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-propoxyacetamide |
|---|---|
| PubChem CID | 103933314 |
| Molecular Formula | C11H23NO3 |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.17 |
| IUPAC Name | N-(3-hydroxy-2,3-dimethylbutan-2-yl)-2-propoxyacetamide |
| SMILES | CCCOCC(=O)NC(C)(C)C(C)(C)O |
| InChI | InChI=1S/C11H23NO3/c1-6-7-15-8-9(13)12-10(2,3)11(4,5)14/h14H,6-8H2,1-5H3,(H,12,13) |
| InChIKey | AUAQOBQCDDBFRF-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|