C19H41N2O4+ — CID 89209628
[2-hydroxy-3-[3-methyl-3-[3-methyl-3-(propanoylamino)butoxy]butoxy]propyl]-trimethylazanium (PubChem CID 89209628) has the molecular formula C19H41N2O4+ and a molecular weight of 361.55 g/mol. Its IUPAC name is [2-hydroxy-3-[3-methyl-3-[3-methyl-3-(propanoylamino)butoxy]butoxy]propyl]-trimethylazanium.
| Compound Name | [2-hydroxy-3-[3-methyl-3-[3-methyl-3-(propanoylamino)butoxy]butoxy]propyl]-trimethylazanium |
|---|---|
| PubChem CID | 89209628 |
| Molecular Formula | C19H41N2O4+ |
| Molecular Weight | 361.55 g/mol |
| Exact Mass | 361.31 |
| IUPAC Name | [2-hydroxy-3-[3-methyl-3-[3-methyl-3-(propanoylamino)butoxy]butoxy]propyl]-trimethylazanium |
| SMILES | CCC(=O)NC(C)(C)CCOC(C)(C)CCOCC(O)C[N+](C)(C)C |
| InChI | InChI=1S/C19H40N2O4/c1-9-17(23)20-18(2,3)10-13-25-19(4,5)11-12-24-15-16(22)14-21(6,7)8/h16,22H,9-15H2,1-8H3/p+1 |
| InChIKey | VFZVSYPOVBKALQ-UHFFFAOYSA-O |
| XLogP | 1.95 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.55 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|